C18H17Cl2N3OS — CID 101197857
N-[[4,5-dichloro-2-(cyclobutylamino)phenyl]carbamothioyl]benzamide (PubChem CID 101197857) has the molecular formula C18H17Cl2N3OS and a molecular weight of 394.33 g/mol. Its IUPAC name is N-[[4,5-dichloro-2-(cyclobutylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | N-[[4,5-dichloro-2-(cyclobutylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 101197857 |
| Molecular Formula | C18H17Cl2N3OS |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-[[4,5-dichloro-2-(cyclobutylamino)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)c(Cl)cc1NC1CCC1)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2N3OS/c19-13-9-15(21-12-7-4-8-12)16(10-14(13)20)22-18(25)23-17(24)11-5-2-1-3-6-11/h1-3,5-6,9-10,12,21H,4,7-8H2,(H2,22,23,24,25) |
| InChIKey | VYALDEQXCZAGNF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|