C13H9Cl2N3OS — CID 13415572
N-[(2,6-dichloro-3-pyridinyl)carbamothioyl]benzamide (PubChem CID 13415572) has the molecular formula C13H9Cl2N3OS and a molecular weight of 326.21 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)carbamothioyl]benzamide.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 13415572 |
| Molecular Formula | C13H9Cl2N3OS |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)nc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H9Cl2N3OS/c14-10-7-6-9(11(15)17-10)16-13(20)18-12(19)8-4-2-1-3-5-8/h1-7H,(H2,16,18,19,20) |
| InChIKey | WTTXVRLJTSDMJZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|