C12H12Cl2N2O3S — CID 91688279
3-(butanoylcarbamothioylamino)-4,5-dichlorobenzoic acid (PubChem CID 91688279) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is 3-(butanoylcarbamothioylamino)-4,5-dichlorobenzoic acid.
| Compound Name | 3-(butanoylcarbamothioylamino)-4,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 91688279 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3-(butanoylcarbamothioylamino)-4,5-dichlorobenzoic acid |
| SMILES | CCCC(=O)NC(=S)Nc1cc(C(=O)O)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3S/c1-2-3-9(17)16-12(20)15-8-5-6(11(18)19)4-7(13)10(8)14/h4-5H,2-3H2,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | USCRILMUBQCPIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|