3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid

C14H10Cl2N2O3 — CID 91682686

IUPAC3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid
SMILESO=C(Nc1ccccc1)Nc1cc(C(=O)O)cc(Cl)c1Cl
InChIInChI=1S/C14H10Cl2N2O3/c15-10-6-8(13(19)20)7-11(12(10)16)18-14(21)17-9-4-2-1-3-5-9/h1-7H,(H,19,20)(H2,17,18,21)
InChIKeyFACFQMVDWUVHNH-UHFFFAOYSA-N
MW325.15 g/mol
LogP4.34
Rot. Bonds3

About 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid

3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid (PubChem CID 91682686) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid
PubChem CID91682686
Molecular FormulaC14H10Cl2N2O3
Molecular Weight325.15 g/mol
Exact Mass324.01
IUPAC Name3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid
SMILESO=C(Nc1ccccc1)Nc1cc(C(=O)O)cc(Cl)c1Cl
InChIInChI=1S/C14H10Cl2N2O3/c15-10-6-8(13(19)20)7-11(12(10)16)18-14(21)17-9-4-2-1-3-5-9/h1-7H,(H,19,20)(H2,17,18,21)
InChIKeyFACFQMVDWUVHNH-UHFFFAOYSA-N
XLogP4.34
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.15
LogP ≤ 54.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid?
The IUPAC name of 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid (CID 91682686) is 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid.
What is the SMILES notation for 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid?
The canonical SMILES for 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid is O=C(Nc1ccccc1)Nc1cc(C(=O)O)cc(Cl)c1Cl.
What is the InChIKey of 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid?
The InChIKey is FACFQMVDWUVHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O3/c15-10-6-8(13(19)20)7-11(12(10)16)18-14(21)17-9-4-2-1-3-5-9/h1-7H,(H,19,20)(H2,17,18,21).
What are the key properties of 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid?
3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid has a molecular weight of 325.15 g/mol, XLogP of 4.34, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-5-(phenylcarbamoylamino)benzoic acid is sourced from PubChem (CID 91682686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).