C15H14Cl3N5O2 — CID 23205948
3,5-dichloro-N-(diaminomethylidene)-4-(phenylcarbamoylamino)benzamide;hydrochloride (PubChem CID 23205948) has the molecular formula C15H14Cl3N5O2 and a molecular weight of 402.67 g/mol. Its IUPAC name is 3,5-dichloro-N-(diaminomethylidene)-4-(phenylcarbamoylamino)benzamide;hydrochloride.
| Compound Name | 3,5-dichloro-N-(diaminomethylidene)-4-(phenylcarbamoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 23205948 |
| Molecular Formula | C15H14Cl3N5O2 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3,5-dichloro-N-(diaminomethylidene)-4-(phenylcarbamoylamino)benzamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1cc(Cl)c(NC(=O)Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N5O2.ClH/c16-10-6-8(13(23)22-14(18)19)7-11(17)12(10)21-15(24)20-9-4-2-1-3-5-9;/h1-7H,(H2,20,21,24)(H4,18,19,22,23);1H |
| InChIKey | FHQMHOLLQYYBPW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|