C12H16Cl3N5O2 — CID 23205951
3,5-dichloro-N-(diaminomethylidene)-4-(propylcarbamoylamino)benzamide;hydrochloride (PubChem CID 23205951) has the molecular formula C12H16Cl3N5O2 and a molecular weight of 368.65 g/mol. Its IUPAC name is 3,5-dichloro-N-(diaminomethylidene)-4-(propylcarbamoylamino)benzamide;hydrochloride.
| Compound Name | 3,5-dichloro-N-(diaminomethylidene)-4-(propylcarbamoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 23205951 |
| Molecular Formula | C12H16Cl3N5O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3,5-dichloro-N-(diaminomethylidene)-4-(propylcarbamoylamino)benzamide;hydrochloride |
| SMILES | CCCNC(=O)Nc1c(Cl)cc(C(=O)N=C(N)N)cc1Cl.Cl |
| InChI | InChI=1S/C12H15Cl2N5O2.ClH/c1-2-3-17-12(21)18-9-7(13)4-6(5-8(9)14)10(20)19-11(15)16;/h4-5H,2-3H2,1H3,(H2,17,18,21)(H4,15,16,19,20);1H |
| InChIKey | XNYBVHBCNSIUEV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|