C13H17Cl2N3O3 — CID 82812445
3,5-dichloro-4-[3-(dimethylamino)propylcarbamoylamino]benzoic acid (PubChem CID 82812445) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is 3,5-dichloro-4-[3-(dimethylamino)propylcarbamoylamino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[3-(dimethylamino)propylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 82812445 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3,5-dichloro-4-[3-(dimethylamino)propylcarbamoylamino]benzoic acid |
| SMILES | CN(C)CCCNC(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O3/c1-18(2)5-3-4-16-13(21)17-11-9(14)6-8(12(19)20)7-10(11)15/h6-7H,3-5H2,1-2H3,(H,19,20)(H2,16,17,21) |
| InChIKey | KIYCBLQSXQFTLY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|