C15H15N5O2S — CID 19422292
S-anilino N-[3-(diaminomethylidenecarbamoyl)phenyl]carbamothioate (PubChem CID 19422292) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is S-anilino N-[3-(diaminomethylidenecarbamoyl)phenyl]carbamothioate.
| Compound Name | S-anilino N-[3-(diaminomethylidenecarbamoyl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 19422292 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | S-anilino N-[3-(diaminomethylidenecarbamoyl)phenyl]carbamothioate |
| SMILES | NC(N)=NC(=O)c1cccc(NC(=O)SNc2ccccc2)c1 |
| InChI | InChI=1S/C15H15N5O2S/c16-14(17)19-13(21)10-5-4-8-12(9-10)18-15(22)23-20-11-6-2-1-3-7-11/h1-9,20H,(H,18,22)(H4,16,17,19,21) |
| InChIKey | QFPVOJLODVTIKF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|