C19H25ClN10O — CID 54610529
1,3-bis[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;hydrochloride (PubChem CID 54610529) has the molecular formula C19H25ClN10O and a molecular weight of 444.93 g/mol. Its IUPAC name is 1,3-bis[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;hydrochloride.
| Compound Name | 1,3-bis[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 54610529 |
| Molecular Formula | C19H25ClN10O |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1,3-bis[3-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;hydrochloride |
| SMILES | C/C(=N/N=C(N)N)c1cccc(NC(=O)Nc2cccc(/C(C)=N\N=C(N)N)c2)c1.Cl |
| InChI | InChI=1S/C19H24N10O.ClH/c1-11(26-28-17(20)21)13-5-3-7-15(9-13)24-19(30)25-16-8-4-6-14(10-16)12(2)27-29-18(22)23;/h3-10H,1-2H3,(H4,20,21,28)(H4,22,23,29)(H2,24,25,30);1H/b26-11-,27-12-; |
| InChIKey | HIMHKQFOCMBAGT-GBTCANJESA-N |
| XLogP | 1.75 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|