C14H22ClN9O — CID 45265177
N-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]acetamide;hydrochloride (PubChem CID 45265177) has the molecular formula C14H22ClN9O and a molecular weight of 367.85 g/mol. Its IUPAC name is N-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]acetamide;hydrochloride.
| Compound Name | N-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45265177 |
| Molecular Formula | C14H22ClN9O |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1cc(/C(C)=N/N=C(N)N)cc(/C(C)=N/N=C(N)N)c1.Cl |
| InChI | InChI=1S/C14H21N9O.ClH/c1-7(20-22-13(15)16)10-4-11(8(2)21-23-14(17)18)6-12(5-10)19-9(3)24;/h4-6H,1-3H3,(H,19,24)(H4,15,16,22)(H4,17,18,23);1H/b20-7+,21-8+; |
| InChIKey | ZZQFAIGYJJEKEG-QVTJNOTLSA-N |
| XLogP | 0.06 |
| TPSA | 182.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|