C20H36N12 — CID 50992447
2-[7-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]anilino]heptyl]guanidine (PubChem CID 50992447) has the molecular formula C20H36N12 and a molecular weight of 444.59 g/mol. Its IUPAC name is 2-[7-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]anilino]heptyl]guanidine.
| Compound Name | 2-[7-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]anilino]heptyl]guanidine |
|---|---|
| PubChem CID | 50992447 |
| Molecular Formula | C20H36N12 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 2-[7-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]anilino]heptyl]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1cc(NCCCCCCCN=C(N)N)cc(/C(C)=N/N=C(N)N)c1 |
| InChI | InChI=1S/C20H36N12/c1-13(29-31-19(23)24)15-10-16(14(2)30-32-20(25)26)12-17(11-15)27-8-6-4-3-5-7-9-28-18(21)22/h10-12,27H,3-9H2,1-2H3,(H4,21,22,28)(H4,23,24,31)(H4,25,26,32)/b29-13+,30-14+ |
| InChIKey | BNSRKLDRYQDNPA-HZUVFDMRSA-N |
| XLogP | 0.32 |
| TPSA | 229.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|