C10H24N4 — CID 10104259
2-[7-(ethylamino)heptyl]guanidine (PubChem CID 10104259) has the molecular formula C10H24N4 and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-[7-(ethylamino)heptyl]guanidine.
| Compound Name | 2-[7-(ethylamino)heptyl]guanidine |
|---|---|
| PubChem CID | 10104259 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | 2-[7-(ethylamino)heptyl]guanidine |
| SMILES | CCNCCCCCCCN=C(N)N |
| InChI | InChI=1S/C10H24N4/c1-2-13-8-6-4-3-5-7-9-14-10(11)12/h13H,2-9H2,1H3,(H4,11,12,14) |
| InChIKey | AJYARMNKTAKAGT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|