About oxalic acid;2-tetradecylguanidine
oxalic acid;2-tetradecylguanidine (PubChem CID 88685065) has the molecular formula C17H35N3O4
and a molecular weight of 345.48 g/mol. Its IUPAC name is oxalic acid;2-tetradecylguanidine.
Molecular Properties
| Compound Name | oxalic acid;2-tetradecylguanidine |
| PubChem CID | 88685065 |
| Molecular Formula | C17H35N3O4 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | oxalic acid;2-tetradecylguanidine |
| SMILES | CCCCCCCCCCCCCCN=C(N)N.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H33N3.C2H2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15(16)17;3-1(4)2(5)6/h2-14H2,1H3,(H4,16,17,18);(H,3,4)(H,5,6) |
| InChIKey | ZPWNFDZEFIZYEU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;2-tetradecylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;2-tetradecylguanidine?
The IUPAC name of oxalic acid;2-tetradecylguanidine (CID 88685065) is oxalic acid;2-tetradecylguanidine.
What is the SMILES notation for oxalic acid;2-tetradecylguanidine?
The canonical SMILES for oxalic acid;2-tetradecylguanidine is CCCCCCCCCCCCCCN=C(N)N.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;2-tetradecylguanidine?
The InChIKey is ZPWNFDZEFIZYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N3.C2H2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15(16)17;3-1(4)2(5)6/h2-14H2,1H3,(H4,16,17,18);(H,3,4)(H,5,6).
What are the key properties of oxalic acid;2-tetradecylguanidine?
oxalic acid;2-tetradecylguanidine has a molecular weight of 345.48 g/mol, XLogP of 3.12, 13 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;2-tetradecylguanidine is sourced from PubChem (CID 88685065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).