C26H54N4O2 — CID 177260030
5-(diaminomethylideneamino)-2-(didecylamino)pentanoic acid (PubChem CID 177260030) has the molecular formula C26H54N4O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(didecylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(didecylamino)pentanoic acid |
|---|---|
| PubChem CID | 177260030 |
| Molecular Formula | C26H54N4O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(didecylamino)pentanoic acid |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H54N4O2/c1-3-5-7-9-11-13-15-17-22-30(23-18-16-14-12-10-8-6-4-2)24(25(31)32)20-19-21-29-26(27)28/h24H,3-23H2,1-2H3,(H,31,32)(H4,27,28,29) |
| InChIKey | YXFOQZJEWXYUQX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|