C13H28ClN5O3 — CID 175320092
(2S)-2-[amino(pentyl)amino]-5-(diaminomethylideneamino)pentanoic acid;2-chloroacetaldehyde (PubChem CID 175320092) has the molecular formula C13H28ClN5O3 and a molecular weight of 337.85 g/mol. Its IUPAC name is (2S)-2-[amino(pentyl)amino]-5-(diaminomethylideneamino)pentanoic acid;2-chloroacetaldehyde.
| Compound Name | (2S)-2-[amino(pentyl)amino]-5-(diaminomethylideneamino)pentanoic acid;2-chloroacetaldehyde |
|---|---|
| PubChem CID | 175320092 |
| Molecular Formula | C13H28ClN5O3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-2-[amino(pentyl)amino]-5-(diaminomethylideneamino)pentanoic acid;2-chloroacetaldehyde |
| SMILES | CCCCCN(N)[C@@H](CCCN=C(N)N)C(=O)O.O=CCCl |
| InChI | InChI=1S/C11H25N5O2.C2H3ClO/c1-2-3-4-8-16(14)9(10(17)18)6-5-7-15-11(12)13;3-1-2-4/h9H,2-8,14H2,1H3,(H,17,18)(H4,12,13,15);2H,1H2/t9-;/m0./s1 |
| InChIKey | QCDDYEBDHGHTBT-FVGYRXGTSA-N |
| XLogP | 0.28 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|