C6H12BrClN4O2 — CID 44815136
2-[bromo(chloro)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 44815136) has the molecular formula C6H12BrClN4O2 and a molecular weight of 287.55 g/mol. Its IUPAC name is 2-[bromo(chloro)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[bromo(chloro)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 44815136 |
| Molecular Formula | C6H12BrClN4O2 |
| Molecular Weight | 287.55 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-[bromo(chloro)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(C(=O)O)N(Cl)Br |
| InChI | InChI=1S/C6H12BrClN4O2/c7-12(8)4(5(13)14)2-1-3-11-6(9)10/h4H,1-3H2,(H,13,14)(H4,9,10,11) |
| InChIKey | UBRIQSALQULOMV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.55 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|