C8H20N4O8P2 — CID 25153759
(2S)-2-[bis(phosphonomethyl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 25153759) has the molecular formula C8H20N4O8P2 and a molecular weight of 362.22 g/mol. Its IUPAC name is (2S)-2-[bis(phosphonomethyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[bis(phosphonomethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 25153759 |
| Molecular Formula | C8H20N4O8P2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (2S)-2-[bis(phosphonomethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N4O8P2/c9-8(10)11-3-1-2-6(7(13)14)12(4-21(15,16)17)5-22(18,19)20/h6H,1-5H2,(H,13,14)(H4,9,10,11)(H2,15,16,17)(H2,18,19,20)/t6-/m0/s1 |
| InChIKey | LJEKXMPODXXXSE-LURJTMIESA-N |
| XLogP | -1.93 |
| TPSA | 220.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|