C9H18N4O4 — CID 87725299
2-[carboxy(ethyl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 87725299) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[carboxy(ethyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[carboxy(ethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 87725299 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[carboxy(ethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCN(C(=O)O)C(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c1-2-13(9(16)17)6(7(14)15)4-3-5-12-8(10)11/h6H,2-5H2,1H3,(H,14,15)(H,16,17)(H4,10,11,12) |
| InChIKey | RDOHUGFHZTXBLF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|