C17H35N7O6 — CID 174654385
2-[(2-aminoacetyl)-pentylamino]-5-(diaminomethylideneamino)pentanoic acid;2,4-diamino-4-oxobutanoic acid (PubChem CID 174654385) has the molecular formula C17H35N7O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)-pentylamino]-5-(diaminomethylideneamino)pentanoic acid;2,4-diamino-4-oxobutanoic acid.
| Compound Name | 2-[(2-aminoacetyl)-pentylamino]-5-(diaminomethylideneamino)pentanoic acid;2,4-diamino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174654385 |
| Molecular Formula | C17H35N7O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-[(2-aminoacetyl)-pentylamino]-5-(diaminomethylideneamino)pentanoic acid;2,4-diamino-4-oxobutanoic acid |
| SMILES | CCCCCN(C(=O)CN)C(CCCN=C(N)N)C(=O)O.NC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C13H27N5O3.C4H8N2O3/c1-2-3-4-8-18(11(19)9-14)10(12(20)21)6-5-7-17-13(15)16;5-2(4(8)9)1-3(6)7/h10H,2-9,14H2,1H3,(H,20,21)(H4,15,16,17);2H,1,5H2,(H2,6,7)(H,8,9) |
| InChIKey | QXVKIZMGFUVRKB-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 254.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|