C22H45N5O5 — CID 91865080
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-[dodecanoyl(methyl)amino]propanoic acid (PubChem CID 91865080) has the molecular formula C22H45N5O5 and a molecular weight of 459.63 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-[dodecanoyl(methyl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-[dodecanoyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 91865080 |
| Molecular Formula | C22H45N5O5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.34 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-[dodecanoyl(methyl)amino]propanoic acid |
| SMILES | CCCCCCCCCCCC(=O)N(C)CCC(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H31NO3.C6H14N4O2/c1-3-4-5-6-7-8-9-10-11-12-15(18)17(2)14-13-16(19)20;7-4(5(11)12)2-1-3-10-6(8)9/h3-14H2,1-2H3,(H,19,20);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | NJBDPVBFMKSIAT-VWMHFEHESA-N |
| XLogP | 2.29 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|