C25H51N5O5 — CID 87730100
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-(hexadecanoylamino)propanoic acid (PubChem CID 87730100) has the molecular formula C25H51N5O5 and a molecular weight of 501.71 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-(hexadecanoylamino)propanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-(hexadecanoylamino)propanoic acid |
|---|---|
| PubChem CID | 87730100 |
| Molecular Formula | C25H51N5O5 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.39 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;3-(hexadecanoylamino)propanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCCC(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C19H37NO3.C6H14N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)20-17-16-19(22)23;7-4(5(11)12)2-1-3-10-6(8)9/h2-17H2,1H3,(H,20,21)(H,22,23);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | WGDXMXPMHRVWMJ-VWMHFEHESA-N |
| XLogP | 3.51 |
| TPSA | 194.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|