About 2-butylguanidine;octadecanoic acid
2-butylguanidine;octadecanoic acid (PubChem CID 158758420) has the molecular formula C23H49N3O2
and a molecular weight of 399.66 g/mol. Its IUPAC name is 2-butylguanidine;octadecanoic acid.
Molecular Properties
| Compound Name | 2-butylguanidine;octadecanoic acid |
| PubChem CID | 158758420 |
| Molecular Formula | C23H49N3O2 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.38 |
| IUPAC Name | 2-butylguanidine;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCN=C(N)N |
| InChI | InChI=1S/C18H36O2.C5H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-8-5(6)7/h2-17H2,1H3,(H,19,20);2-4H2,1H3,(H4,6,7,8) |
| InChIKey | IOJBBJRJLNFXEN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butylguanidine;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylguanidine;octadecanoic acid?
The IUPAC name of 2-butylguanidine;octadecanoic acid (CID 158758420) is 2-butylguanidine;octadecanoic acid.
What is the SMILES notation for 2-butylguanidine;octadecanoic acid?
The canonical SMILES for 2-butylguanidine;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.CCCCN=C(N)N.
What is the InChIKey of 2-butylguanidine;octadecanoic acid?
The InChIKey is IOJBBJRJLNFXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C5H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-8-5(6)7/h2-17H2,1H3,(H,19,20);2-4H2,1H3,(H4,6,7,8).
What are the key properties of 2-butylguanidine;octadecanoic acid?
2-butylguanidine;octadecanoic acid has a molecular weight of 399.66 g/mol, XLogP of 6.39, 19 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylguanidine;octadecanoic acid is sourced from PubChem (CID 158758420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).