About azane;carbamic acid;hexadecanoic acid
azane;carbamic acid;hexadecanoic acid (PubChem CID 174832395) has the molecular formula C17H38N2O4
and a molecular weight of 334.50 g/mol. Its IUPAC name is azane;carbamic acid;hexadecanoic acid.
Molecular Properties
| Compound Name | azane;carbamic acid;hexadecanoic acid |
| PubChem CID | 174832395 |
| Molecular Formula | C17H38N2O4 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | azane;carbamic acid;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.N.NC(=O)O |
| InChI | InChI=1S/C16H32O2.CH3NO2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;2-1(3)4;/h2-15H2,1H3,(H,17,18);2H2,(H,3,4);1H3 |
| InChIKey | SRYMPYRHURICIV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;carbamic acid;hexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbamic acid;hexadecanoic acid?
The IUPAC name of azane;carbamic acid;hexadecanoic acid (CID 174832395) is azane;carbamic acid;hexadecanoic acid.
What is the SMILES notation for azane;carbamic acid;hexadecanoic acid?
The canonical SMILES for azane;carbamic acid;hexadecanoic acid is CCCCCCCCCCCCCCCC(=O)O.N.NC(=O)O.
What is the InChIKey of azane;carbamic acid;hexadecanoic acid?
The InChIKey is SRYMPYRHURICIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.CH3NO2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;2-1(3)4;/h2-15H2,1H3,(H,17,18);2H2,(H,3,4);1H3.
What are the key properties of azane;carbamic acid;hexadecanoic acid?
azane;carbamic acid;hexadecanoic acid has a molecular weight of 334.50 g/mol, XLogP of 5.34, 14 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbamic acid;hexadecanoic acid is sourced from PubChem (CID 174832395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).