C10H22N4O4 — CID 87394286
(2S)-2-[bis(2-hydroxyethyl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 87394286) has the molecular formula C10H22N4O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2S)-2-[bis(2-hydroxyethyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[bis(2-hydroxyethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 87394286 |
| Molecular Formula | C10H22N4O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (2S)-2-[bis(2-hydroxyethyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N(CCO)CCO |
| InChI | InChI=1S/C10H22N4O4/c11-10(12)13-3-1-2-8(9(17)18)14(4-6-15)5-7-16/h8,15-16H,1-7H2,(H,17,18)(H4,11,12,13)/t8-/m0/s1 |
| InChIKey | YHUHHOPPWUHYGK-QMMMGPOBSA-N |
| XLogP | -2.22 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|