C9H19N4O6P — CID 87477675
5-(diaminomethylideneamino)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanoic acid (PubChem CID 87477675) has the molecular formula C9H19N4O6P and a molecular weight of 310.25 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 87477675 |
| Molecular Formula | C9H19N4O6P |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanoic acid |
| SMILES | C=CC(N(O)C(CCCN=C(N)N)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H19N4O6P/c1-2-7(20(17,18)19)13(16)6(8(14)15)4-3-5-12-9(10)11/h2,6-7,16H,1,3-5H2,(H,14,15)(H4,10,11,12)(H2,17,18,19) |
| InChIKey | PPYGXXVJOPGPDK-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 182.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|