C13H26N4O8P2 — CID 87494090
(2S)-2-[bis(1-phosphonoprop-2-enyl)amino]-5-(diaminomethylideneamino)-2-methylpentanoic acid (PubChem CID 87494090) has the molecular formula C13H26N4O8P2 and a molecular weight of 428.32 g/mol. Its IUPAC name is (2S)-2-[bis(1-phosphonoprop-2-enyl)amino]-5-(diaminomethylideneamino)-2-methylpentanoic acid.
| Compound Name | (2S)-2-[bis(1-phosphonoprop-2-enyl)amino]-5-(diaminomethylideneamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 87494090 |
| Molecular Formula | C13H26N4O8P2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2S)-2-[bis(1-phosphonoprop-2-enyl)amino]-5-(diaminomethylideneamino)-2-methylpentanoic acid |
| SMILES | C=CC(N(C(C=C)P(=O)(O)O)[C@@](C)(CCCN=C(N)N)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H26N4O8P2/c1-4-9(26(20,21)22)17(10(5-2)27(23,24)25)13(3,11(18)19)7-6-8-16-12(14)15/h4-5,9-10H,1-2,6-8H2,3H3,(H,18,19)(H4,14,15,16)(H2,20,21,22)(H2,23,24,25)/t9?,10?,13-/m0/s1 |
| InChIKey | VRIXVSRZTJKZRW-ZPPKWKGLSA-N |
| XLogP | -0.44 |
| TPSA | 220.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|