C11H20N2O9P2 — CID 87490662
5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-5-oxopentanoic acid (PubChem CID 87490662) has the molecular formula C11H20N2O9P2 and a molecular weight of 386.23 g/mol. Its IUPAC name is 5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87490662 |
| Molecular Formula | C11H20N2O9P2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-5-oxopentanoic acid |
| SMILES | C=CC(N(C(CCC(N)=O)C(=O)O)C(C=C)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H20N2O9P2/c1-3-9(23(17,18)19)13(10(4-2)24(20,21)22)7(11(15)16)5-6-8(12)14/h3-4,7,9-10H,1-2,5-6H2,(H2,12,14)(H,15,16)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | KXLSDDNMKQBKAU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|