C9H17NO8P2 — CID 87495989
2-[bis(1-phosphonoprop-2-enyl)amino]propanoic acid (PubChem CID 87495989) has the molecular formula C9H17NO8P2 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2-[bis(1-phosphonoprop-2-enyl)amino]propanoic acid.
| Compound Name | 2-[bis(1-phosphonoprop-2-enyl)amino]propanoic acid |
|---|---|
| PubChem CID | 87495989 |
| Molecular Formula | C9H17NO8P2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-[bis(1-phosphonoprop-2-enyl)amino]propanoic acid |
| SMILES | C=CC(N(C(C)C(=O)O)C(C=C)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H17NO8P2/c1-4-7(19(13,14)15)10(6(3)9(11)12)8(5-2)20(16,17)18/h4-8H,1-2H2,3H3,(H,11,12)(H2,13,14,15)(H2,16,17,18) |
| InChIKey | AYFUXCBYQHZJJQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|