C11H21NO8P2 — CID 87492014
2-[bis(1-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid (PubChem CID 87492014) has the molecular formula C11H21NO8P2 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-[bis(1-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[bis(1-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87492014 |
| Molecular Formula | C11H21NO8P2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[bis(1-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid |
| SMILES | C=CC(N(C(C(=O)O)C(C)C)C(C=C)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H21NO8P2/c1-5-8(21(15,16)17)12(9(6-2)22(18,19)20)10(7(3)4)11(13)14/h5-10H,1-2H2,3-4H3,(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | SDPNKQBIDGRQPU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|