C8H16NO6P — CID 173088646
(2S)-2-[hydroxy(3-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid (PubChem CID 173088646) has the molecular formula C8H16NO6P and a molecular weight of 253.19 g/mol. Its IUPAC name is (2S)-2-[hydroxy(3-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[hydroxy(3-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 173088646 |
| Molecular Formula | C8H16NO6P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (2S)-2-[hydroxy(3-phosphonoprop-2-enyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(O)CC=CP(=O)(O)O |
| InChI | InChI=1S/C8H16NO6P/c1-6(2)7(8(10)11)9(12)4-3-5-16(13,14)15/h3,5-7,12H,4H2,1-2H3,(H,10,11)(H2,13,14,15)/t7-/m0/s1 |
| InChIKey | KZJCXNWWBKTOKQ-ZETCQYMHSA-N |
| XLogP | 0.48 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|