C20H38N2O8 — CID 87096245
2-[carboxymethyl(propan-2-yl)amino]-3-methylbutanoic acid (PubChem CID 87096245) has the molecular formula C20H38N2O8 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-[carboxymethyl(propan-2-yl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[carboxymethyl(propan-2-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87096245 |
| Molecular Formula | C20H38N2O8 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-[carboxymethyl(propan-2-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(CC(=O)O)C(C)C.CC(C)C(C(=O)O)N(CC(=O)O)C(C)C |
| InChI | InChI=1S/2C10H19NO4/c2*1-6(2)9(10(14)15)11(7(3)4)5-8(12)13/h2*6-7,9H,5H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | GJPTVCFJBBOPCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |