C8H13NO7 — CID 139761783
(2S)-2-[1-carboxyethyl(carboxymethyl)amino]-3-hydroxypropanoic acid (PubChem CID 139761783) has the molecular formula C8H13NO7 and a molecular weight of 235.19 g/mol. Its IUPAC name is (2S)-2-[1-carboxyethyl(carboxymethyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[1-carboxyethyl(carboxymethyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 139761783 |
| Molecular Formula | C8H13NO7 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (2S)-2-[1-carboxyethyl(carboxymethyl)amino]-3-hydroxypropanoic acid |
| SMILES | CC(C(=O)O)N(CC(=O)O)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H13NO7/c1-4(7(13)14)9(2-6(11)12)5(3-10)8(15)16/h4-5,10H,2-3H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t4?,5-/m0/s1 |
| InChIKey | ZPIVFGZCPDRFDM-AKGZTFGVSA-N |
| XLogP | -1.71 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |