C7H11NNa3O7+3 — CID 91979731
trisodium;(2S)-2-[bis(carboxymethyl)amino]-3-hydroxypropanoic acid (PubChem CID 91979731) has the molecular formula C7H11NNa3O7+3 and a molecular weight of 290.13 g/mol. Its IUPAC name is trisodium;(2S)-2-[bis(carboxymethyl)amino]-3-hydroxypropanoic acid.
| Compound Name | trisodium;(2S)-2-[bis(carboxymethyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 91979731 |
| Molecular Formula | C7H11NNa3O7+3 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | trisodium;(2S)-2-[bis(carboxymethyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)[C@@H](CO)C(=O)O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H11NO7.3Na/c9-3-4(7(14)15)8(1-5(10)11)2-6(12)13;;;/h4,9H,1-3H2,(H,10,11)(H,12,13)(H,14,15);;;/q;3*+1/t4-;;;/m0.../s1 |
| InChIKey | OVXKVGHEOJHEJN-WJXVXWFNSA-N |
| XLogP | -11.08 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | -11.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |