C7H9NNa2O7 — CID 159253768
disodium;2-[[(1S)-1-carboxy-2-hydroxyethyl]-(carboxylatomethyl)amino]acetate (PubChem CID 159253768) has the molecular formula C7H9NNa2O7 and a molecular weight of 265.13 g/mol. Its IUPAC name is disodium;2-[[(1S)-1-carboxy-2-hydroxyethyl]-(carboxylatomethyl)amino]acetate.
| Compound Name | disodium;2-[[(1S)-1-carboxy-2-hydroxyethyl]-(carboxylatomethyl)amino]acetate |
|---|---|
| PubChem CID | 159253768 |
| Molecular Formula | C7H9NNa2O7 |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | disodium;2-[[(1S)-1-carboxy-2-hydroxyethyl]-(carboxylatomethyl)amino]acetate |
| SMILES | O=C([O-])CN(CC(=O)[O-])[C@@H](CO)C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C7H11NO7.2Na/c9-3-4(7(14)15)8(1-5(10)11)2-6(12)13;;/h4,9H,1-3H2,(H,10,11)(H,12,13)(H,14,15);;/q;2*+1/p-2/t4-;;/m0../s1 |
| InChIKey | KVPZWVBHVFPEEG-FHNDMYTFSA-L |
| XLogP | -10.76 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | -10.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |