C6H9NNa2O5 — CID 22151994
disodium;2-[carboxylatomethyl(1-hydroxyethyl)amino]acetate (PubChem CID 22151994) has the molecular formula C6H9NNa2O5 and a molecular weight of 221.12 g/mol. Its IUPAC name is disodium;2-[carboxylatomethyl(1-hydroxyethyl)amino]acetate.
| Compound Name | disodium;2-[carboxylatomethyl(1-hydroxyethyl)amino]acetate |
|---|---|
| PubChem CID | 22151994 |
| Molecular Formula | C6H9NNa2O5 |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | disodium;2-[carboxylatomethyl(1-hydroxyethyl)amino]acetate |
| SMILES | CC(O)N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H11NO5.2Na/c1-4(8)7(2-5(9)10)3-6(11)12;;/h4,8H,2-3H2,1H3,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | GALFQPOIMRROOD-UHFFFAOYSA-L |
| XLogP | -9.87 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | -9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|