C8H13NNa2O6 — CID 87962220
disodium;(2S)-2-[bis(1-hydroxyethyl)amino]butanedioate (PubChem CID 87962220) has the molecular formula C8H13NNa2O6 and a molecular weight of 265.17 g/mol. Its IUPAC name is disodium;(2S)-2-[bis(1-hydroxyethyl)amino]butanedioate.
| Compound Name | disodium;(2S)-2-[bis(1-hydroxyethyl)amino]butanedioate |
|---|---|
| PubChem CID | 87962220 |
| Molecular Formula | C8H13NNa2O6 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | disodium;(2S)-2-[bis(1-hydroxyethyl)amino]butanedioate |
| SMILES | CC(O)N(C(C)O)[C@@H](CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H15NO6.2Na/c1-4(10)9(5(2)11)6(8(14)15)3-7(12)13;;/h4-6,10-11H,3H2,1-2H3,(H,12,13)(H,14,15);;/q;2*+1/p-2/t4?,5?,6-;;/m0../s1 |
| InChIKey | BJURDNFTFHZHBA-NPAXKIATSA-L |
| XLogP | -9.77 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | -9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|