C6H9NNa2O6 — CID 139890235
disodium;(2S)-2-(2,2-dihydroxyethylamino)butanedioate (PubChem CID 139890235) has the molecular formula C6H9NNa2O6 and a molecular weight of 237.12 g/mol. Its IUPAC name is disodium;(2S)-2-(2,2-dihydroxyethylamino)butanedioate.
| Compound Name | disodium;(2S)-2-(2,2-dihydroxyethylamino)butanedioate |
|---|---|
| PubChem CID | 139890235 |
| Molecular Formula | C6H9NNa2O6 |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | disodium;(2S)-2-(2,2-dihydroxyethylamino)butanedioate |
| SMILES | O=C([O-])C[C@H](NCC(O)O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H11NO6.2Na/c8-4(9)1-3(6(12)13)7-2-5(10)11;;/h3,5,7,10-11H,1-2H2,(H,8,9)(H,12,13);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | OMPINXYCRMMYJV-QTNFYWBSSA-L |
| XLogP | -10.85 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | -10.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|