sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate

C5H10NNaO4 — CID 141052836

IUPACsodium (2S)-2-(2,2-dihydroxyethylamino)propanoate
SMILESC[C@H](NCC(O)O)C(=O)[O-].[Na+]
InChIInChI=1S/C5H11NO4.Na/c1-3(5(9)10)6-2-4(7)8;/h3-4,6-8H,2H2,1H3,(H,9,10);/q;+1/p-1/t3-;/m0./s1
InChIKeyVCWWSFCZCPDICG-DFWYDOINSA-M
MW171.13 g/mol
LogP-5.97
Rot. Bonds4

About sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate

sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate (PubChem CID 141052836) has the molecular formula C5H10NNaO4 and a molecular weight of 171.13 g/mol. Its IUPAC name is sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate.

Molecular Properties

Compound Namesodium (2S)-2-(2,2-dihydroxyethylamino)propanoate
PubChem CID141052836
Molecular FormulaC5H10NNaO4
Molecular Weight171.13 g/mol
Exact Mass171.05
IUPAC Namesodium (2S)-2-(2,2-dihydroxyethylamino)propanoate
SMILESC[C@H](NCC(O)O)C(=O)[O-].[Na+]
InChIInChI=1S/C5H11NO4.Na/c1-3(5(9)10)6-2-4(7)8;/h3-4,6-8H,2H2,1H3,(H,9,10);/q;+1/p-1/t3-;/m0./s1
InChIKeyVCWWSFCZCPDICG-DFWYDOINSA-M
XLogP-5.97
TPSA92.62 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.13
LogP ≤ 5-5.97
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate?
The IUPAC name of sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate (CID 141052836) is sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate.
What is the SMILES notation for sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate?
The canonical SMILES for sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate is C[C@H](NCC(O)O)C(=O)[O-].[Na+].
What is the InChIKey of sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate?
The InChIKey is VCWWSFCZCPDICG-DFWYDOINSA-M. The full InChI is InChI=1S/C5H11NO4.Na/c1-3(5(9)10)6-2-4(7)8;/h3-4,6-8H,2H2,1H3,(H,9,10);/q;+1/p-1/t3-;/m0./s1.
What are the key properties of sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate?
sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate has a molecular weight of 171.13 g/mol, XLogP of -5.97, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate is sourced from PubChem (CID 141052836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).