C5H10NNaO4 — CID 141052836
sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate (PubChem CID 141052836) has the molecular formula C5H10NNaO4 and a molecular weight of 171.13 g/mol. Its IUPAC name is sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate.
| Compound Name | sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate |
|---|---|
| PubChem CID | 141052836 |
| Molecular Formula | C5H10NNaO4 |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | sodium (2S)-2-(2,2-dihydroxyethylamino)propanoate |
| SMILES | C[C@H](NCC(O)O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H11NO4.Na/c1-3(5(9)10)6-2-4(7)8;/h3-4,6-8H,2H2,1H3,(H,9,10);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | VCWWSFCZCPDICG-DFWYDOINSA-M |
| XLogP | -5.97 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | -5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|