C11H21LiN2O3 — CID 101284217
lithium 2-[2-(2-hydroxyhex-5-enylamino)ethylamino]propanoate (PubChem CID 101284217) has the molecular formula C11H21LiN2O3 and a molecular weight of 236.24 g/mol. Its IUPAC name is lithium 2-[2-(2-hydroxyhex-5-enylamino)ethylamino]propanoate.
| Compound Name | lithium 2-[2-(2-hydroxyhex-5-enylamino)ethylamino]propanoate |
|---|---|
| PubChem CID | 101284217 |
| Molecular Formula | C11H21LiN2O3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | lithium 2-[2-(2-hydroxyhex-5-enylamino)ethylamino]propanoate |
| SMILES | C=CCCC(O)CNCCNC(C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C11H22N2O3.Li/c1-3-4-5-10(14)8-12-6-7-13-9(2)11(15)16;/h3,9-10,12-14H,1,4-8H2,2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | GIMXBSCEXZLMFR-UHFFFAOYSA-M |
| XLogP | -4.36 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|