C17H31N2NaO4 — CID 101284083
sodium 3-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhex-5-enylamino)ethyl]amino]propanoate (PubChem CID 101284083) has the molecular formula C17H31N2NaO4 and a molecular weight of 350.44 g/mol. Its IUPAC name is sodium 3-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhex-5-enylamino)ethyl]amino]propanoate.
| Compound Name | sodium 3-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhex-5-enylamino)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 101284083 |
| Molecular Formula | C17H31N2NaO4 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | sodium 3-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhex-5-enylamino)ethyl]amino]propanoate |
| SMILES | C=CCCC(O)CNCCN(CCC(=O)[O-])CC(O)CCC=C.[Na+] |
| InChI | InChI=1S/C17H32N2O4.Na/c1-3-5-7-15(20)13-18-10-12-19(11-9-17(22)23)14-16(21)8-6-4-2;/h3-4,15-16,18,20-21H,1-2,5-14H2,(H,22,23);/q;+1/p-1 |
| InChIKey | AZMFPUMRZHCWPG-UHFFFAOYSA-M |
| XLogP | -3.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|