C17H34N2O4 — CID 101283957
2-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhexylamino)ethyl]amino]propanoic acid (PubChem CID 101283957) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhexylamino)ethyl]amino]propanoic acid.
| Compound Name | 2-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhexylamino)ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101283957 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 2-[2-hydroxyhex-5-enyl-[2-(2-hydroxyhexylamino)ethyl]amino]propanoic acid |
| SMILES | C=CCCC(O)CN(CCNCC(O)CCCC)C(C)C(=O)O |
| InChI | InChI=1S/C17H34N2O4/c1-4-6-8-15(20)12-18-10-11-19(14(3)17(22)23)13-16(21)9-7-5-2/h5,14-16,18,20-21H,2,4,6-13H2,1,3H3,(H,22,23) |
| InChIKey | QFHZNFDLUXMBHY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|