C17H33N2NaO4 — CID 101283988
sodium (Z)-1-[2-carboxyethyl-[2-(2-hydroxyhexylamino)ethyl]amino]hex-1-en-2-olate (PubChem CID 101283988) has the molecular formula C17H33N2NaO4 and a molecular weight of 352.45 g/mol. Its IUPAC name is sodium (Z)-1-[2-carboxyethyl-[2-(2-hydroxyhexylamino)ethyl]amino]hex-1-en-2-olate.
| Compound Name | sodium (Z)-1-[2-carboxyethyl-[2-(2-hydroxyhexylamino)ethyl]amino]hex-1-en-2-olate |
|---|---|
| PubChem CID | 101283988 |
| Molecular Formula | C17H33N2NaO4 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | sodium (Z)-1-[2-carboxyethyl-[2-(2-hydroxyhexylamino)ethyl]amino]hex-1-en-2-olate |
| SMILES | CCCC/C([O-])=C/N(CCNCC(O)CCCC)CCC(=O)O.[Na+] |
| InChI | InChI=1S/C17H34N2O4.Na/c1-3-5-7-15(20)13-18-10-12-19(11-9-17(22)23)14-16(21)8-6-4-2;/h14-15,18,20-21H,3-13H2,1-2H3,(H,22,23);/q;+1/p-1/b16-14-; |
| InChIKey | WIEVZDBPGJABMG-ULQCMBKMSA-M |
| XLogP | -1.70 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|