About 1-(ethylamino)hexan-2-ol
1-(ethylamino)hexan-2-ol (PubChem CID 54078804) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 1-(ethylamino)hexan-2-ol.
Molecular Properties
| Compound Name | 1-(ethylamino)hexan-2-ol |
| PubChem CID | 54078804 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 1-(ethylamino)hexan-2-ol |
| SMILES | CCCCC(O)CNCC |
| InChI | InChI=1S/C8H19NO/c1-3-5-6-8(10)7-9-4-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | YXZQELVGQPLUMG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(ethylamino)hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)hexan-2-ol?
The IUPAC name of 1-(ethylamino)hexan-2-ol (CID 54078804) is 1-(ethylamino)hexan-2-ol.
What is the SMILES notation for 1-(ethylamino)hexan-2-ol?
The canonical SMILES for 1-(ethylamino)hexan-2-ol is CCCCC(O)CNCC.
What is the InChIKey of 1-(ethylamino)hexan-2-ol?
The InChIKey is YXZQELVGQPLUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-3-5-6-8(10)7-9-4-2/h8-10H,3-7H2,1-2H3.
What are the key properties of 1-(ethylamino)hexan-2-ol?
1-(ethylamino)hexan-2-ol has a molecular weight of 145.25 g/mol, XLogP of 1.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)hexan-2-ol is sourced from PubChem (CID 54078804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).