C30H64N2O8 — CID 159703654
1-[6-(2-hydroxynonylamino)hexylamino]nonan-2-ol;bis(2-hydroxypropanoic acid) (PubChem CID 159703654) has the molecular formula C30H64N2O8 and a molecular weight of 580.85 g/mol. Its IUPAC name is 1-[6-(2-hydroxynonylamino)hexylamino]nonan-2-ol;bis(2-hydroxypropanoic acid).
| Compound Name | 1-[6-(2-hydroxynonylamino)hexylamino]nonan-2-ol;bis(2-hydroxypropanoic acid) |
|---|---|
| PubChem CID | 159703654 |
| Molecular Formula | C30H64N2O8 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.47 |
| IUPAC Name | 1-[6-(2-hydroxynonylamino)hexylamino]nonan-2-ol;bis(2-hydroxypropanoic acid) |
| SMILES | CC(O)C(=O)O.CC(O)C(=O)O.CCCCCCCC(O)CNCCCCCCNCC(O)CCCCCCC |
| InChI | InChI=1S/C24H52N2O2.2C3H6O3/c1-3-5-7-9-13-17-23(27)21-25-19-15-11-12-16-20-26-22-24(28)18-14-10-8-6-4-2;2*1-2(4)3(5)6/h23-28H,3-22H2,1-2H3;2*2,4H,1H3,(H,5,6) |
| InChIKey | MXXZVZLWYIUPAC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|