C32H66N2O6 — CID 21332461
butanedioic acid;1-[6-(2-hydroxyundecylamino)hexylamino]undecan-2-ol (PubChem CID 21332461) has the molecular formula C32H66N2O6 and a molecular weight of 574.89 g/mol. Its IUPAC name is butanedioic acid;1-[6-(2-hydroxyundecylamino)hexylamino]undecan-2-ol.
| Compound Name | butanedioic acid;1-[6-(2-hydroxyundecylamino)hexylamino]undecan-2-ol |
|---|---|
| PubChem CID | 21332461 |
| Molecular Formula | C32H66N2O6 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.49 |
| IUPAC Name | butanedioic acid;1-[6-(2-hydroxyundecylamino)hexylamino]undecan-2-ol |
| SMILES | CCCCCCCCCC(O)CNCCCCCCNCC(O)CCCCCCCCC.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C28H60N2O2.C4H6O4/c1-3-5-7-9-11-13-17-21-27(31)25-29-23-19-15-16-20-24-30-26-28(32)22-18-14-12-10-8-6-4-2;5-3(6)1-2-4(7)8/h27-32H,3-26H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | KCVOHHITAJAVQH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|