N-butylbutan-1-amine;10-hydroxyoctadecanoic acid

C26H55NO3 — CID 88787428

IUPACN-butylbutan-1-amine;10-hydroxyoctadecanoic acid
SMILESCCCCCCCCC(O)CCCCCCCCC(=O)O.CCCCNCCCC
InChIInChI=1S/C18H36O3.C8H19N/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21;1-3-5-7-9-8-6-4-2/h17,19H,2-16H2,1H3,(H,20,21);9H,3-8H2,1-2H3
InChIKeyOPBCPAIIPLJUKO-UHFFFAOYSA-N
MW429.73 g/mol
LogP7.48
Rot. Bonds22

About N-butylbutan-1-amine;10-hydroxyoctadecanoic acid

N-butylbutan-1-amine;10-hydroxyoctadecanoic acid (PubChem CID 88787428) has the molecular formula C26H55NO3 and a molecular weight of 429.73 g/mol. Its IUPAC name is N-butylbutan-1-amine;10-hydroxyoctadecanoic acid.

Molecular Properties

Compound NameN-butylbutan-1-amine;10-hydroxyoctadecanoic acid
PubChem CID88787428
Molecular FormulaC26H55NO3
Molecular Weight429.73 g/mol
Exact Mass429.42
IUPAC NameN-butylbutan-1-amine;10-hydroxyoctadecanoic acid
SMILESCCCCCCCCC(O)CCCCCCCCC(=O)O.CCCCNCCCC
InChIInChI=1S/C18H36O3.C8H19N/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21;1-3-5-7-9-8-6-4-2/h17,19H,2-16H2,1H3,(H,20,21);9H,3-8H2,1-2H3
InChIKeyOPBCPAIIPLJUKO-UHFFFAOYSA-N
XLogP7.48
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds22
Heavy Atoms30
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500429.73
LogP ≤ 57.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze N-butylbutan-1-amine;10-hydroxyoctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The IUPAC name of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid (CID 88787428) is N-butylbutan-1-amine;10-hydroxyoctadecanoic acid.
What is the SMILES notation for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The canonical SMILES for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid is CCCCCCCCC(O)CCCCCCCCC(=O)O.CCCCNCCCC.
What is the InChIKey of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The InChIKey is OPBCPAIIPLJUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.C8H19N/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21;1-3-5-7-9-8-6-4-2/h17,19H,2-16H2,1H3,(H,20,21);9H,3-8H2,1-2H3.
What are the key properties of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
N-butylbutan-1-amine;10-hydroxyoctadecanoic acid has a molecular weight of 429.73 g/mol, XLogP of 7.48, 22 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid is sourced from PubChem (CID 88787428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).