About N-butylbutan-1-amine;10-hydroxyoctadecanoic acid
N-butylbutan-1-amine;10-hydroxyoctadecanoic acid (PubChem CID 88787428) has the molecular formula C26H55NO3
and a molecular weight of 429.73 g/mol. Its IUPAC name is N-butylbutan-1-amine;10-hydroxyoctadecanoic acid.
Molecular Properties
| Compound Name | N-butylbutan-1-amine;10-hydroxyoctadecanoic acid |
| PubChem CID | 88787428 |
| Molecular Formula | C26H55NO3 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 429.42 |
| IUPAC Name | N-butylbutan-1-amine;10-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCCC(O)CCCCCCCCC(=O)O.CCCCNCCCC |
| InChI | InChI=1S/C18H36O3.C8H19N/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21;1-3-5-7-9-8-6-4-2/h17,19H,2-16H2,1H3,(H,20,21);9H,3-8H2,1-2H3 |
| InChIKey | OPBCPAIIPLJUKO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylbutan-1-amine;10-hydroxyoctadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The IUPAC name of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid (CID 88787428) is N-butylbutan-1-amine;10-hydroxyoctadecanoic acid.
What is the SMILES notation for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The canonical SMILES for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid is CCCCCCCCC(O)CCCCCCCCC(=O)O.CCCCNCCCC.
What is the InChIKey of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
The InChIKey is OPBCPAIIPLJUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.C8H19N/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21;1-3-5-7-9-8-6-4-2/h17,19H,2-16H2,1H3,(H,20,21);9H,3-8H2,1-2H3.
What are the key properties of N-butylbutan-1-amine;10-hydroxyoctadecanoic acid?
N-butylbutan-1-amine;10-hydroxyoctadecanoic acid has a molecular weight of 429.73 g/mol, XLogP of 7.48, 22 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylbutan-1-amine;10-hydroxyoctadecanoic acid is sourced from PubChem (CID 88787428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).