C11H21N2NaO3 — CID 101284188
sodium (Z)-1-[2-(2-carboxyethylamino)ethylamino]hex-1-en-2-olate (PubChem CID 101284188) has the molecular formula C11H21N2NaO3 and a molecular weight of 252.29 g/mol. Its IUPAC name is sodium (Z)-1-[2-(2-carboxyethylamino)ethylamino]hex-1-en-2-olate.
| Compound Name | sodium (Z)-1-[2-(2-carboxyethylamino)ethylamino]hex-1-en-2-olate |
|---|---|
| PubChem CID | 101284188 |
| Molecular Formula | C11H21N2NaO3 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | sodium (Z)-1-[2-(2-carboxyethylamino)ethylamino]hex-1-en-2-olate |
| SMILES | CCCC/C(=C/NCCNCCC(=O)O)/[O-].[Na+] |
| InChI | InChI=1S/C11H22N2O3.Na/c1-2-3-4-10(14)9-13-8-7-12-6-5-11(15)16;/h9,12-14H,2-8H2,1H3,(H,15,16);/q;+1/p-1/b10-9-; |
| InChIKey | LDAHRQLHZGAFES-KVVVOXFISA-M |
| XLogP | — |
| TPSA | 84.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | 223 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|