3-(pentylamino)propanoic acid

C8H17NO2 — CID 28830294

IUPAC3-(pentylamino)propanoic acid
SMILESCCCCCNCCC(=O)O
InChIInChI=1S/C8H17NO2/c1-2-3-4-6-9-7-5-8(10)11/h9H,2-7H2,1H3,(H,10,11)
InChIKeyHLIKIPDETHLRHM-UHFFFAOYSA-N
MW159.23 g/mol
LogP1.24
Rot. Bonds7

About 3-(pentylamino)propanoic acid

3-(pentylamino)propanoic acid (PubChem CID 28830294) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(pentylamino)propanoic acid.

Molecular Properties

Compound Name3-(pentylamino)propanoic acid
PubChem CID28830294
Molecular FormulaC8H17NO2
Molecular Weight159.23 g/mol
Exact Mass159.13
IUPAC Name3-(pentylamino)propanoic acid
SMILESCCCCCNCCC(=O)O
InChIInChI=1S/C8H17NO2/c1-2-3-4-6-9-7-5-8(10)11/h9H,2-7H2,1H3,(H,10,11)
InChIKeyHLIKIPDETHLRHM-UHFFFAOYSA-N
XLogP1.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.23
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(pentylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(pentylamino)propanoic acid?
The IUPAC name of 3-(pentylamino)propanoic acid (CID 28830294) is 3-(pentylamino)propanoic acid.
What is the SMILES notation for 3-(pentylamino)propanoic acid?
The canonical SMILES for 3-(pentylamino)propanoic acid is CCCCCNCCC(=O)O.
What is the InChIKey of 3-(pentylamino)propanoic acid?
The InChIKey is HLIKIPDETHLRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-2-3-4-6-9-7-5-8(10)11/h9H,2-7H2,1H3,(H,10,11).
What are the key properties of 3-(pentylamino)propanoic acid?
3-(pentylamino)propanoic acid has a molecular weight of 159.23 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pentylamino)propanoic acid is sourced from PubChem (CID 28830294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).