C17H28K2N2O7 — CID 101285091
dipotassium;2-[2-[1-carboxyethyl(1-carboxylatoethyl)amino]ethyl-(2-hydroxyhex-5-enyl)amino]propanoate (PubChem CID 101285091) has the molecular formula C17H28K2N2O7 and a molecular weight of 450.61 g/mol. Its IUPAC name is dipotassium;2-[2-[1-carboxyethyl(1-carboxylatoethyl)amino]ethyl-(2-hydroxyhex-5-enyl)amino]propanoate.
| Compound Name | dipotassium;2-[2-[1-carboxyethyl(1-carboxylatoethyl)amino]ethyl-(2-hydroxyhex-5-enyl)amino]propanoate |
|---|---|
| PubChem CID | 101285091 |
| Molecular Formula | C17H28K2N2O7 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | dipotassium;2-[2-[1-carboxyethyl(1-carboxylatoethyl)amino]ethyl-(2-hydroxyhex-5-enyl)amino]propanoate |
| SMILES | C=CCCC(O)CN(CCN(C(C)C(=O)[O-])C(C)C(=O)O)C(C)C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C17H30N2O7.2K/c1-5-6-7-14(20)10-18(11(2)15(21)22)8-9-19(12(3)16(23)24)13(4)17(25)26;;/h5,11-14,20H,1,6-10H2,2-4H3,(H,21,22)(H,23,24)(H,25,26);;/q;2*+1/p-2 |
| InChIKey | GEKMJDYGOVUUEJ-UHFFFAOYSA-L |
| XLogP | -8.32 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | -8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|