C19H34NNaO2 — CID 101313401
sodium 2-[bis(oct-7-enyl)amino]propanoate (PubChem CID 101313401) has the molecular formula C19H34NNaO2 and a molecular weight of 331.48 g/mol. Its IUPAC name is sodium 2-[bis(oct-7-enyl)amino]propanoate.
| Compound Name | sodium 2-[bis(oct-7-enyl)amino]propanoate |
|---|---|
| PubChem CID | 101313401 |
| Molecular Formula | C19H34NNaO2 |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | sodium 2-[bis(oct-7-enyl)amino]propanoate |
| SMILES | C=CCCCCCCN(CCCCCCC=C)C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H35NO2.Na/c1-4-6-8-10-12-14-16-20(18(3)19(21)22)17-15-13-11-9-7-5-2;/h4-5,18H,1-2,6-17H2,3H3,(H,21,22);/q;+1/p-1 |
| InChIKey | RTMYHPVULWKLJS-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|